C12H9O6- — CID 6928203
5,8-dimethoxy-4-oxochromene-2-carboxylate (PubChem CID 6928203) has the molecular formula C12H9O6- and a molecular weight of 249.20 g/mol. Its IUPAC name is 5,8-dimethoxy-4-oxochromene-2-carboxylate.
| Compound Name | 5,8-dimethoxy-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 6928203 |
| Molecular Formula | C12H9O6- |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 5,8-dimethoxy-4-oxochromene-2-carboxylate |
| SMILES | COc1ccc(OC)c2c(=O)cc(C(=O)[O-])oc12 |
| InChI | InChI=1S/C12H10O6/c1-16-7-3-4-8(17-2)11-10(7)6(13)5-9(18-11)12(14)15/h3-5H,1-2H3,(H,14,15)/p-1 |
| InChIKey | KJLPUHZDFLXPIR-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 88.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |