C10H6ClO4- — CID 2060034
5-chloro-7-methoxy-1-benzofuran-2-carboxylate (PubChem CID 2060034) has the molecular formula C10H6ClO4- and a molecular weight of 225.61 g/mol. Its IUPAC name is 5-chloro-7-methoxy-1-benzofuran-2-carboxylate.
| Compound Name | 5-chloro-7-methoxy-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 2060034 |
| Molecular Formula | C10H6ClO4- |
| Molecular Weight | 225.61 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | 5-chloro-7-methoxy-1-benzofuran-2-carboxylate |
| SMILES | COc1cc(Cl)cc2cc(C(=O)[O-])oc12 |
| InChI | InChI=1S/C10H7ClO4/c1-14-7-4-6(11)2-5-3-8(10(12)13)15-9(5)7/h2-4H,1H3,(H,12,13)/p-1 |
| InChIKey | SJIWXWCGQMFLNE-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 62.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.61 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |