C15H15ClO3 — CID 104666651
(5-chloro-7-methoxy-1-benzofuran-2-yl)-cyclopentylmethanone (PubChem CID 104666651) has the molecular formula C15H15ClO3 and a molecular weight of 278.74 g/mol. Its IUPAC name is (5-chloro-7-methoxy-1-benzofuran-2-yl)-cyclopentylmethanone.
| Compound Name | (5-chloro-7-methoxy-1-benzofuran-2-yl)-cyclopentylmethanone |
|---|---|
| PubChem CID | 104666651 |
| Molecular Formula | C15H15ClO3 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (5-chloro-7-methoxy-1-benzofuran-2-yl)-cyclopentylmethanone |
| SMILES | COc1cc(Cl)cc2cc(C(=O)C3CCCC3)oc12 |
| InChI | InChI=1S/C15H15ClO3/c1-18-13-8-11(16)6-10-7-12(19-15(10)13)14(17)9-4-2-3-5-9/h6-9H,2-5H2,1H3 |
| InChIKey | ADSIXQXHTRTAQU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |