C16H16ClNO5S — CID 157014808
[(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(5-chloro-7-methoxy-1-benzofuran-2-yl)methanone (PubChem CID 157014808) has the molecular formula C16H16ClNO5S and a molecular weight of 369.83 g/mol. Its IUPAC name is [(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(5-chloro-7-methoxy-1-benzofuran-2-yl)methanone.
| Compound Name | [(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(5-chloro-7-methoxy-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 157014808 |
| Molecular Formula | C16H16ClNO5S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | [(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(5-chloro-7-methoxy-1-benzofuran-2-yl)methanone |
| SMILES | COc1cc(Cl)cc2cc(C(=O)N3C[C@@H]4CCS(=O)(=O)[C@@H]4C3)oc12 |
| InChI | InChI=1S/C16H16ClNO5S/c1-22-12-6-11(17)4-10-5-13(23-15(10)12)16(19)18-7-9-2-3-24(20,21)14(9)8-18/h4-6,9,14H,2-3,7-8H2,1H3/t9-,14+/m0/s1 |
| InChIKey | HDJDSCKLMDDBCS-LKFCYVNXSA-N |
| XLogP | 2.35 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |