C27H27ClFN3O6 — CID 165423309
(1R,16S)-18-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-6-fluoro-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione (PubChem CID 165423309) has the molecular formula C27H27ClFN3O6 and a molecular weight of 543.98 g/mol. Its IUPAC name is (1R,16S)-18-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-6-fluoro-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione.
| Compound Name | (1R,16S)-18-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-6-fluoro-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione |
|---|---|
| PubChem CID | 165423309 |
| Molecular Formula | C27H27ClFN3O6 |
| Molecular Weight | 543.98 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | (1R,16S)-18-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-6-fluoro-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione |
| SMILES | COc1cc(Cl)cc2cc(C(=O)N3C[C@H]4CC[C@@H](C3)C(=O)NCCCOc3ccc(F)cc3C(=O)N4)oc12 |
| InChI | InChI=1S/C27H27ClFN3O6/c1-36-22-11-17(28)9-16-10-23(38-24(16)22)27(35)32-13-15-3-5-19(14-32)31-26(34)20-12-18(29)4-6-21(20)37-8-2-7-30-25(15)33/h4,6,9-12,15,19H,2-3,5,7-8,13-14H2,1H3,(H,30,33)(H,31,34)/t15-,19+/m0/s1 |
| InChIKey | ALJOLJJHKNJZAP-HNAYVOBHSA-N |
| XLogP | 3.78 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.98 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |