C22H25FN4O4 — CID 165420120
(1R,16S)-6-fluoro-18-(1H-pyrrole-3-carbonyl)-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione (PubChem CID 165420120) has the molecular formula C22H25FN4O4 and a molecular weight of 428.46 g/mol. Its IUPAC name is (1R,16S)-6-fluoro-18-(1H-pyrrole-3-carbonyl)-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione.
| Compound Name | (1R,16S)-6-fluoro-18-(1H-pyrrole-3-carbonyl)-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione |
|---|---|
| PubChem CID | 165420120 |
| Molecular Formula | C22H25FN4O4 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (1R,16S)-6-fluoro-18-(1H-pyrrole-3-carbonyl)-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione |
| SMILES | O=C1N[C@@H]2CC[C@@H](CN(C(=O)c3cc[nH]c3)C2)C(=O)NCCCOc2ccc(F)cc21 |
| InChI | InChI=1S/C22H25FN4O4/c23-16-3-5-19-18(10-16)21(29)26-17-4-2-15(20(28)25-7-1-9-31-19)12-27(13-17)22(30)14-6-8-24-11-14/h3,5-6,8,10-11,15,17,24H,1-2,4,7,9,12-13H2,(H,25,28)(H,26,29)/t15-,17+/m0/s1 |
| InChIKey | IWOXXLICMCSFQW-DOTOQJQBSA-N |
| XLogP | 1.70 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |