C15H17NO4 — CID 104525479
7-(oxane-2-carbonyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 104525479) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 7-(oxane-2-carbonyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 7-(oxane-2-carbonyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 104525479 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 7-(oxane-2-carbonyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | O=C1NCCOc2ccc(C(=O)C3CCCCO3)cc21 |
| InChI | InChI=1S/C15H17NO4/c17-14(13-3-1-2-7-19-13)10-4-5-12-11(9-10)15(18)16-6-8-20-12/h4-5,9,13H,1-3,6-8H2,(H,16,18) |
| InChIKey | XKJICMIYIIZTSG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |