C10H11NO3 — CID 104526353
7-(hydroxymethyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 104526353) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 7-(hydroxymethyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 7-(hydroxymethyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 104526353 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 7-(hydroxymethyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | O=C1NCCOc2ccc(CO)cc21 |
| InChI | InChI=1S/C10H11NO3/c12-6-7-1-2-9-8(5-7)10(13)11-3-4-14-9/h1-2,5,12H,3-4,6H2,(H,11,13) |
| InChIKey | ZWGKQYVXTFKGAT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |