C10H7ClO4 — CID 2060035
5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid (PubChem CID 2060035) has the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. Its IUPAC name is 5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 2060035 |
| Molecular Formula | C10H7ClO4 |
| Molecular Weight | 226.61 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid |
| SMILES | COc1cc(Cl)cc2cc(C(=O)O)oc12 |
| InChI | InChI=1S/C10H7ClO4/c1-14-7-4-6(11)2-5-3-8(10(12)13)15-9(5)7/h2-4H,1H3,(H,12,13) |
| InChIKey | SJIWXWCGQMFLNE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |