C18H22Cl2N2O4 — CID 172912161
N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-chloro-7-methoxy-1-benzofuran-2-carboxamide;hydrochloride (PubChem CID 172912161) has the molecular formula C18H22Cl2N2O4 and a molecular weight of 401.29 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-chloro-7-methoxy-1-benzofuran-2-carboxamide;hydrochloride.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-chloro-7-methoxy-1-benzofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172912161 |
| Molecular Formula | C18H22Cl2N2O4 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-chloro-7-methoxy-1-benzofuran-2-carboxamide;hydrochloride |
| SMILES | COc1cc(Cl)cc2cc(C(=O)N[C@H]3C[C@H]4CNC[C@H]4C[C@@H]3O)oc12.Cl |
| InChI | InChI=1S/C18H21ClN2O4.ClH/c1-24-15-6-12(19)2-9-5-16(25-17(9)15)18(23)21-13-3-10-7-20-8-11(10)4-14(13)22;/h2,5-6,10-11,13-14,20,22H,3-4,7-8H2,1H3,(H,21,23);1H/t10-,11+,13-,14-;/m0./s1 |
| InChIKey | ACZAYNSUWVOIFI-BKOKFWBPSA-N |
| XLogP | 2.61 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |