C17H25ClN2O4 — CID 172910364
N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,3-dimethoxybenzamide;hydrochloride (PubChem CID 172910364) has the molecular formula C17H25ClN2O4 and a molecular weight of 356.85 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,3-dimethoxybenzamide;hydrochloride.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,3-dimethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 172910364 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,3-dimethoxybenzamide;hydrochloride |
| SMILES | COc1cccc(C(=O)N[C@H]2C[C@H]3CNC[C@H]3C[C@@H]2O)c1OC.Cl |
| InChI | InChI=1S/C17H24N2O4.ClH/c1-22-15-5-3-4-12(16(15)23-2)17(21)19-13-6-10-8-18-9-11(10)7-14(13)20;/h3-5,10-11,13-14,18,20H,6-9H2,1-2H3,(H,19,21);1H/t10-,11+,13-,14-;/m0./s1 |
| InChIKey | LYQBTXQKNJJTIL-BKOKFWBPSA-N |
| XLogP | 1.21 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |