C16H21NO7 — CID 91780909
2-[(3R,4S)-3-[(2,3-dimethoxybenzoyl)amino]oxan-4-yl]oxyacetic acid (PubChem CID 91780909) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[(2,3-dimethoxybenzoyl)amino]oxan-4-yl]oxyacetic acid.
| Compound Name | 2-[(3R,4S)-3-[(2,3-dimethoxybenzoyl)amino]oxan-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 91780909 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[(3R,4S)-3-[(2,3-dimethoxybenzoyl)amino]oxan-4-yl]oxyacetic acid |
| SMILES | COc1cccc(C(=O)N[C@@H]2COCC[C@@H]2OCC(=O)O)c1OC |
| InChI | InChI=1S/C16H21NO7/c1-21-13-5-3-4-10(15(13)22-2)16(20)17-11-8-23-7-6-12(11)24-9-14(18)19/h3-5,11-12H,6-9H2,1-2H3,(H,17,20)(H,18,19)/t11-,12+/m1/s1 |
| InChIKey | TVDPIEKFHSJIIN-NEPJUHHUSA-N |
| XLogP | 0.69 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |