C15H9NO8 — CID 13455101
5-methoxy-4,7-dioxo-10H-pyrano[3,2-h]quinoline-2,9-dicarboxylic acid (PubChem CID 13455101) has the molecular formula C15H9NO8 and a molecular weight of 331.24 g/mol. Its IUPAC name is 5-methoxy-4,7-dioxo-10H-pyrano[3,2-h]quinoline-2,9-dicarboxylic acid.
| Compound Name | 5-methoxy-4,7-dioxo-10H-pyrano[3,2-h]quinoline-2,9-dicarboxylic acid |
|---|---|
| PubChem CID | 13455101 |
| Molecular Formula | C15H9NO8 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 5-methoxy-4,7-dioxo-10H-pyrano[3,2-h]quinoline-2,9-dicarboxylic acid |
| SMILES | COc1cc2c(=O)cc(C(=O)O)[nH]c2c2oc(C(=O)O)cc(=O)c12 |
| InChI | InChI=1S/C15H9NO8/c1-23-9-2-5-7(17)3-6(14(19)20)16-12(5)13-11(9)8(18)4-10(24-13)15(21)22/h2-4H,1H3,(H,16,17)(H,19,20)(H,21,22) |
| InChIKey | XVWUGFWCTRLQBS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|