C14H7O6- — CID 6975739
4-methyl-2,10-dioxopyrano[2,3-f]chromene-8-carboxylate (PubChem CID 6975739) has the molecular formula C14H7O6- and a molecular weight of 271.20 g/mol. Its IUPAC name is 4-methyl-2,10-dioxopyrano[2,3-f]chromene-8-carboxylate.
| Compound Name | 4-methyl-2,10-dioxopyrano[2,3-f]chromene-8-carboxylate |
|---|---|
| PubChem CID | 6975739 |
| Molecular Formula | C14H7O6- |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 4-methyl-2,10-dioxopyrano[2,3-f]chromene-8-carboxylate |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(C(=O)[O-])cc(=O)c12 |
| InChI | InChI=1S/C14H8O6/c1-6-4-11(16)20-13-7(6)2-3-9-12(13)8(15)5-10(19-9)14(17)18/h2-5H,1H3,(H,17,18)/p-1 |
| InChIKey | GXVVJCKXVILLPA-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 100.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|