About 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one
8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one (PubChem CID 4573532) has the molecular formula C22H21N3O4
and a molecular weight of 391.43 g/mol. Its IUPAC name is 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one.
Molecular Properties
| Compound Name | 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one |
| PubChem CID | 4573532 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one |
| SMILES | CCN(CC)c1ccc(/N=N/c2oc3ccc4c(C)cc(=O)oc4c3c2O)cc1 |
| InChI | InChI=1S/C22H21N3O4/c1-4-25(5-2)15-8-6-14(7-9-15)23-24-22-20(27)19-17(28-22)11-10-16-13(3)12-18(26)29-21(16)19/h6-12,27H,4-5H2,1-3H3/b24-23+ |
| InChIKey | KHANOYDYOSKUFP-WCWDXBQESA-N |
| XLogP | 5.81 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one?
The IUPAC name of 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one (CID 4573532) is 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one.
What is the SMILES notation for 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one?
The canonical SMILES for 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one is CCN(CC)c1ccc(/N=N/c2oc3ccc4c(C)cc(=O)oc4c3c2O)cc1.
What is the InChIKey of 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one?
The InChIKey is KHANOYDYOSKUFP-WCWDXBQESA-N. The full InChI is InChI=1S/C22H21N3O4/c1-4-25(5-2)15-8-6-14(7-9-15)23-24-22-20(27)19-17(28-22)11-10-16-13(3)12-18(26)29-21(16)19/h6-12,27H,4-5H2,1-3H3/b24-23+.
What are the key properties of 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one?
8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one has a molecular weight of 391.43 g/mol, XLogP of 5.81, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[[4-(diethylamino)phenyl]diazenyl]-9-hydroxy-4-methylfuro[2,3-h]chromen-2-one is sourced from PubChem (CID 4573532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).