C20H23N3O4 — CID 3058824
N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 3058824) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 3058824 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-(4,8-dimethyl-2-oxofuro[2,3-h]chromen-9-yl)-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | Cc1oc2ccc3c(C)cc(=O)oc3c2c1NC(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C20H23N3O4/c1-12-10-17(25)27-20-14(12)4-5-15-18(20)19(13(2)26-15)21-16(24)11-23-8-6-22(3)7-9-23/h4-5,10H,6-9,11H2,1-3H3,(H,21,24) |
| InChIKey | MPJPYBWVGQBWSO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|