C21H25N5O5S — CID 17024200
2-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-N-(4-methyl-2-oxochromen-7-yl)acetamide (PubChem CID 17024200) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is 2-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-N-(4-methyl-2-oxochromen-7-yl)acetamide.
| Compound Name | 2-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-N-(4-methyl-2-oxochromen-7-yl)acetamide |
|---|---|
| PubChem CID | 17024200 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-N-(4-methyl-2-oxochromen-7-yl)acetamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)CN3CCN(S(=O)(=O)c4cnn(C)c4C)CC3)ccc12 |
| InChI | InChI=1S/C21H25N5O5S/c1-14-10-21(28)31-18-11-16(4-5-17(14)18)23-20(27)13-25-6-8-26(9-7-25)32(29,30)19-12-22-24(3)15(19)2/h4-5,10-12H,6-9,13H2,1-3H3,(H,23,27) |
| InChIKey | YQCYSYVFGXELCX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|