C15H10O7 — CID 88718270
methyl (4-methyl-2,10-dioxopyrano[2,3-f]chromen-8-yl) carbonate (PubChem CID 88718270) has the molecular formula C15H10O7 and a molecular weight of 302.24 g/mol. Its IUPAC name is methyl (4-methyl-2,10-dioxopyrano[2,3-f]chromen-8-yl) carbonate.
| Compound Name | methyl (4-methyl-2,10-dioxopyrano[2,3-f]chromen-8-yl) carbonate |
|---|---|
| PubChem CID | 88718270 |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | methyl (4-methyl-2,10-dioxopyrano[2,3-f]chromen-8-yl) carbonate |
| SMILES | COC(=O)Oc1cc(=O)c2c(ccc3c(C)cc(=O)oc32)o1 |
| InChI | InChI=1S/C15H10O7/c1-7-5-11(17)21-14-8(7)3-4-10-13(14)9(16)6-12(20-10)22-15(18)19-2/h3-6H,1-2H3 |
| InChIKey | BOYCOZYMUZOYAX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 95.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|