C20H21NO9S — CID 141103624
2-methoxy-5-(5,6,7,8-tetramethoxy-4-oxochromen-2-yl)benzenesulfonamide (PubChem CID 141103624) has the molecular formula C20H21NO9S and a molecular weight of 451.45 g/mol. Its IUPAC name is 2-methoxy-5-(5,6,7,8-tetramethoxy-4-oxochromen-2-yl)benzenesulfonamide.
| Compound Name | 2-methoxy-5-(5,6,7,8-tetramethoxy-4-oxochromen-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 141103624 |
| Molecular Formula | C20H21NO9S |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 2-methoxy-5-(5,6,7,8-tetramethoxy-4-oxochromen-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C20H21NO9S/c1-25-12-7-6-10(8-14(12)31(21,23)24)13-9-11(22)15-16(26-2)18(27-3)20(29-5)19(28-4)17(15)30-13/h6-9H,1-5H3,(H2,21,23,24) |
| InChIKey | KAYREGHSVWVLIV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |