C20H19NO9 — CID 44583489
5,6,7,8-tetramethoxy-2-(4-methoxy-3-nitrophenyl)chromen-4-one (PubChem CID 44583489) has the molecular formula C20H19NO9 and a molecular weight of 417.37 g/mol. Its IUPAC name is 5,6,7,8-tetramethoxy-2-(4-methoxy-3-nitrophenyl)chromen-4-one.
| Compound Name | 5,6,7,8-tetramethoxy-2-(4-methoxy-3-nitrophenyl)chromen-4-one |
|---|---|
| PubChem CID | 44583489 |
| Molecular Formula | C20H19NO9 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 5,6,7,8-tetramethoxy-2-(4-methoxy-3-nitrophenyl)chromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19NO9/c1-25-13-7-6-10(8-11(13)21(23)24)14-9-12(22)15-16(26-2)18(27-3)20(29-5)19(28-4)17(15)30-14/h6-9H,1-5H3 |
| InChIKey | XNYZHBIVYLEBMS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 119.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|