C20H19NO8 — CID 11850777
3-(4-methoxy-3-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-2H-furan-5-one (PubChem CID 11850777) has the molecular formula C20H19NO8 and a molecular weight of 401.37 g/mol. Its IUPAC name is 3-(4-methoxy-3-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-2H-furan-5-one.
| Compound Name | 3-(4-methoxy-3-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 11850777 |
| Molecular Formula | C20H19NO8 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-(4-methoxy-3-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-2H-furan-5-one |
| SMILES | COc1ccc(C2=C(c3cc(OC)c(OC)c(OC)c3)C(=O)OC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19NO8/c1-25-15-6-5-11(7-14(15)21(23)24)13-10-29-20(22)18(13)12-8-16(26-2)19(28-4)17(9-12)27-3/h5-9H,10H2,1-4H3 |
| InChIKey | XWHAWFFYARBMRS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|