C22H22O9 — CID 122205259
3,4-bis(3,4,5-trimethoxyphenyl)furan-2,5-dione (PubChem CID 122205259) has the molecular formula C22H22O9 and a molecular weight of 430.41 g/mol. Its IUPAC name is 3,4-bis(3,4,5-trimethoxyphenyl)furan-2,5-dione.
| Compound Name | 3,4-bis(3,4,5-trimethoxyphenyl)furan-2,5-dione |
|---|---|
| PubChem CID | 122205259 |
| Molecular Formula | C22H22O9 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3,4-bis(3,4,5-trimethoxyphenyl)furan-2,5-dione |
| SMILES | COc1cc(C2=C(c3cc(OC)c(OC)c(OC)c3)C(=O)OC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H22O9/c1-25-13-7-11(8-14(26-2)19(13)29-5)17-18(22(24)31-21(17)23)12-9-15(27-3)20(30-6)16(10-12)28-4/h7-10H,1-6H3 |
| InChIKey | BXDCUSIGMTVHNY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|