C21H22O8 — CID 45276907
5,6,7-trimethoxy-4-(3,4,5-trimethoxyphenyl)chromen-2-one (PubChem CID 45276907) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 5,6,7-trimethoxy-4-(3,4,5-trimethoxyphenyl)chromen-2-one.
| Compound Name | 5,6,7-trimethoxy-4-(3,4,5-trimethoxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 45276907 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 5,6,7-trimethoxy-4-(3,4,5-trimethoxyphenyl)chromen-2-one |
| SMILES | COc1cc(-c2cc(=O)oc3cc(OC)c(OC)c(OC)c23)cc(OC)c1OC |
| InChI | InChI=1S/C21H22O8/c1-23-14-7-11(8-15(24-2)19(14)26-4)12-9-17(22)29-13-10-16(25-3)20(27-5)21(28-6)18(12)13/h7-10H,1-6H3 |
| InChIKey | YKYVMHSVOKUXSX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|