C27H26O8 — CID 11317561
4-(3,5-dimethoxy-4-phenylmethoxyphenyl)-5,6,7-trimethoxychromen-2-one (PubChem CID 11317561) has the molecular formula C27H26O8 and a molecular weight of 478.50 g/mol. Its IUPAC name is 4-(3,5-dimethoxy-4-phenylmethoxyphenyl)-5,6,7-trimethoxychromen-2-one.
| Compound Name | 4-(3,5-dimethoxy-4-phenylmethoxyphenyl)-5,6,7-trimethoxychromen-2-one |
|---|---|
| PubChem CID | 11317561 |
| Molecular Formula | C27H26O8 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 4-(3,5-dimethoxy-4-phenylmethoxyphenyl)-5,6,7-trimethoxychromen-2-one |
| SMILES | COc1cc(-c2cc(=O)oc3cc(OC)c(OC)c(OC)c23)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H26O8/c1-29-20-11-17(12-21(30-2)25(20)34-15-16-9-7-6-8-10-16)18-13-23(28)35-19-14-22(31-3)26(32-4)27(33-5)24(18)19/h6-14H,15H2,1-5H3 |
| InChIKey | ICHTYBMLXSGWMP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|