C35H35O10P — CID 89415314
4-[3-[bis(phenylmethoxymethyl)phosphoryloxy]-4-methoxyphenyl]-6,7,8-trimethoxychromen-2-one (PubChem CID 89415314) has the molecular formula C35H35O10P and a molecular weight of 646.63 g/mol. Its IUPAC name is 4-[3-[bis(phenylmethoxymethyl)phosphoryloxy]-4-methoxyphenyl]-6,7,8-trimethoxychromen-2-one.
| Compound Name | 4-[3-[bis(phenylmethoxymethyl)phosphoryloxy]-4-methoxyphenyl]-6,7,8-trimethoxychromen-2-one |
|---|---|
| PubChem CID | 89415314 |
| Molecular Formula | C35H35O10P |
| Molecular Weight | 646.63 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | 4-[3-[bis(phenylmethoxymethyl)phosphoryloxy]-4-methoxyphenyl]-6,7,8-trimethoxychromen-2-one |
| SMILES | COc1ccc(-c2cc(=O)oc3c(OC)c(OC)c(OC)cc23)cc1OP(=O)(COCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C35H35O10P/c1-38-29-16-15-26(27-19-32(36)44-33-28(27)18-31(39-2)34(40-3)35(33)41-4)17-30(29)45-46(37,22-42-20-24-11-7-5-8-12-24)23-43-21-25-13-9-6-10-14-25/h5-19H,20-23H2,1-4H3 |
| InChIKey | BPNIDHUXRLUPFK-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 111.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.63 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|