C31H30FO7P — CID 11577721
dibenzyl [5-[(Z)-2-(3-fluoro-4,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] phosphate (PubChem CID 11577721) has the molecular formula C31H30FO7P and a molecular weight of 564.55 g/mol. Its IUPAC name is dibenzyl [5-[(Z)-2-(3-fluoro-4,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] phosphate.
| Compound Name | dibenzyl [5-[(Z)-2-(3-fluoro-4,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] phosphate |
|---|---|
| PubChem CID | 11577721 |
| Molecular Formula | C31H30FO7P |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | dibenzyl [5-[(Z)-2-(3-fluoro-4,5-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] phosphate |
| SMILES | COc1ccc(/C=C\c2cc(F)c(OC)c(OC)c2)cc1OP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H30FO7P/c1-34-28-17-16-23(14-15-26-18-27(32)31(36-3)30(20-26)35-2)19-29(28)39-40(33,37-21-24-10-6-4-7-11-24)38-22-25-12-8-5-9-13-25/h4-20H,21-22H2,1-3H3/b15-14- |
| InChIKey | QZQHTGSNQMUTJN-PFONDFGASA-N |
| XLogP | 7.94 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|