C64H68O16P2 — CID 91462583
dibenzyl hydrogen phosphite;dibenzyl [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (PubChem CID 91462583) has the molecular formula C64H68O16P2 and a molecular weight of 1155.18 g/mol. Its IUPAC name is dibenzyl hydrogen phosphite;dibenzyl [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
| Compound Name | dibenzyl hydrogen phosphite;dibenzyl [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 91462583 |
| Molecular Formula | C64H68O16P2 |
| Molecular Weight | 1155.18 g/mol |
| Exact Mass | 1154.40 |
| IUPAC Name | dibenzyl hydrogen phosphite;dibenzyl [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O.COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)(OCc1ccccc1)OCc1ccccc1.OP(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C32H33O8P.C18H20O5.C14H15O3P/c1-34-28-18-17-24(15-16-27-20-30(35-2)32(37-4)31(21-27)36-3)19-29(28)40-41(33,38-22-25-11-7-5-8-12-25)39-23-26-13-9-6-10-14-26;1-20-15-8-7-12(9-14(15)19)5-6-13-10-16(21-2)18(23-4)17(11-13)22-3;15-18(16-11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h5-21H,22-23H2,1-4H3;5-11,19H,1-4H3;1-10,15H,11-12H2/b16-15-;6-5-; |
| InChIKey | CBHSRXOUZCLGET-HFIYYWPCSA-N |
| XLogP | 15.05 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1155.18 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|