C22H32NO11P — CID 67409278
[2-amino-3-hydroxy-2-(hydroxymethyl)propyl] dihydrogen phosphate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (PubChem CID 67409278) has the molecular formula C22H32NO11P and a molecular weight of 517.47 g/mol. Its IUPAC name is [2-amino-3-hydroxy-2-(hydroxymethyl)propyl] dihydrogen phosphate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
| Compound Name | [2-amino-3-hydroxy-2-(hydroxymethyl)propyl] dihydrogen phosphate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 67409278 |
| Molecular Formula | C22H32NO11P |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | [2-amino-3-hydroxy-2-(hydroxymethyl)propyl] dihydrogen phosphate;2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O.NC(CO)(CO)COP(=O)(O)O |
| InChI | InChI=1S/C18H20O5.C4H12NO6P/c1-20-15-8-7-12(9-14(15)19)5-6-13-10-16(21-2)18(23-4)17(11-13)22-3;5-4(1-6,2-7)3-11-12(8,9)10/h5-11,19H,1-4H3;6-7H,1-3,5H2,(H2,8,9,10)/b6-5-; |
| InChIKey | CDGBIFCLOUWLTB-YSMBQZINSA-N |
| XLogP | 1.37 |
| TPSA | 190.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|