C19H23NO7S — CID 137451049
[2-ethoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] sulfamate (PubChem CID 137451049) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is [2-ethoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] sulfamate.
| Compound Name | [2-ethoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 137451049 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [2-ethoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] sulfamate |
| SMILES | CCOc1ccc(/C=C/c2cc(OC)c(OC)c(OC)c2)cc1OS(N)(=O)=O |
| InChI | InChI=1S/C19H23NO7S/c1-5-26-15-9-8-13(10-16(15)27-28(20,21)22)6-7-14-11-17(23-2)19(25-4)18(12-14)24-3/h6-12H,5H2,1-4H3,(H2,20,21,22)/b7-6+ |
| InChIKey | OLZYETOBYVDFNY-VOTSOKGWSA-N |
| XLogP | 2.86 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|