C20H23BrO5 — CID 56935715
5-[(Z)-2-[3-(2-bromoethoxy)-4-methoxyphenyl]ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 56935715) has the molecular formula C20H23BrO5 and a molecular weight of 423.30 g/mol. Its IUPAC name is 5-[(Z)-2-[3-(2-bromoethoxy)-4-methoxyphenyl]ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(Z)-2-[3-(2-bromoethoxy)-4-methoxyphenyl]ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 56935715 |
| Molecular Formula | C20H23BrO5 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 5-[(Z)-2-[3-(2-bromoethoxy)-4-methoxyphenyl]ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OCCBr |
| InChI | InChI=1S/C20H23BrO5/c1-22-16-8-7-14(11-17(16)26-10-9-21)5-6-15-12-18(23-2)20(25-4)19(13-15)24-3/h5-8,11-13H,9-10H2,1-4H3/b6-5- |
| InChIKey | XGVJZSJHOQLWQC-WAYWQWQTSA-N |
| XLogP | 4.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|