C26H25BrO3 — CID 11561767
2-(2-bromoethoxy)-1,4-bis[(E)-2-(4-methoxyphenyl)ethenyl]benzene (PubChem CID 11561767) has the molecular formula C26H25BrO3 and a molecular weight of 465.39 g/mol. Its IUPAC name is 2-(2-bromoethoxy)-1,4-bis[(E)-2-(4-methoxyphenyl)ethenyl]benzene.
| Compound Name | 2-(2-bromoethoxy)-1,4-bis[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 11561767 |
| Molecular Formula | C26H25BrO3 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 2-(2-bromoethoxy)-1,4-bis[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
| SMILES | COc1ccc(/C=C/c2ccc(/C=C/c3ccc(OC)cc3)c(OCCBr)c2)cc1 |
| InChI | InChI=1S/C26H25BrO3/c1-28-24-13-7-20(8-14-24)3-4-22-6-12-23(26(19-22)30-18-17-27)11-5-21-9-15-25(29-2)16-10-21/h3-16,19H,17-18H2,1-2H3/b4-3+,11-5+ |
| InChIKey | XCEYZNXRYRAYCQ-ZHBGKXFASA-N |
| XLogP | 6.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|