C26H25FO3 — CID 11509622
2-(2-(18F)fluoroethoxy)-1,4-bis[(E)-2-(4-methoxyphenyl)ethenyl]benzene (PubChem CID 11509622) has the molecular formula C26H25FO3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-(2-(18F)fluoroethoxy)-1,4-bis[(E)-2-(4-methoxyphenyl)ethenyl]benzene.
| Compound Name | 2-(2-(18F)fluoroethoxy)-1,4-bis[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 11509622 |
| Molecular Formula | C26H25FO3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-(2-(18F)fluoroethoxy)-1,4-bis[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
| SMILES | COc1ccc(/C=C/c2ccc(/C=C/c3ccc(OC)cc3)c(OCC[18F])c2)cc1 |
| InChI | InChI=1S/C26H25FO3/c1-28-24-13-7-20(8-14-24)3-4-22-6-12-23(26(19-22)30-18-17-27)11-5-21-9-15-25(29-2)16-10-21/h3-16,19H,17-18H2,1-2H3/b4-3+,11-5+/i27-1 |
| InChIKey | PVRONSBEPNUKPY-HPVSNYPZSA-N |
| XLogP | 6.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|