C27H40O6Si — CID 11156035
tert-butyl-[3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propoxy]-dimethylsilane (PubChem CID 11156035) has the molecular formula C27H40O6Si and a molecular weight of 488.70 g/mol. Its IUPAC name is tert-butyl-[3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11156035 |
| Molecular Formula | C27H40O6Si |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | tert-butyl-[3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propoxy]-dimethylsilane |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H40O6Si/c1-27(2,3)34(8,9)33-16-10-15-32-23-17-20(13-14-22(23)28-4)11-12-21-18-24(29-5)26(31-7)25(19-21)30-6/h11-14,17-19H,10,15-16H2,1-9H3/b12-11- |
| InChIKey | YIOVUOGOLDCPEY-QXMHVHEDSA-N |
| XLogP | 6.68 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|