C21H21NO8S — CID 59455971
[4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] sulfamate (PubChem CID 59455971) has the molecular formula C21H21NO8S and a molecular weight of 447.47 g/mol. Its IUPAC name is [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] sulfamate.
| Compound Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] sulfamate |
|---|---|
| PubChem CID | 59455971 |
| Molecular Formula | C21H21NO8S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] sulfamate |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OS(N)(=O)=O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H21NO8S/c1-28-20-11-14(5-9-18(20)25)3-7-16(23)13-17(24)8-4-15-6-10-19(21(12-15)29-2)30-31(22,26)27/h3-12,25H,13H2,1-2H3,(H2,22,26,27)/b7-3+,8-4+ |
| InChIKey | MXELXBKHKASIEW-FCXRPNKRSA-N |
| XLogP | 2.25 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|