C21H22N2O5 — CID 137179154
(1E,6E)-5-hydrazinylidene-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-dien-3-one (PubChem CID 137179154) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (1E,6E)-5-hydrazinylidene-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-dien-3-one.
| Compound Name | (1E,6E)-5-hydrazinylidene-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 137179154 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (1E,6E)-5-hydrazinylidene-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)CC(/C=C/c2ccc(O)c(OC)c2)=NN)ccc1O |
| InChI | InChI=1S/C21H22N2O5/c1-27-20-11-14(5-9-18(20)25)3-7-16(23-22)13-17(24)8-4-15-6-10-19(26)21(12-15)28-2/h3-12,25-26H,13,22H2,1-2H3/b7-3+,8-4+,23-16? |
| InChIKey | UXXKEORNTNKJII-OVQRDCHBSA-N |
| XLogP | 3.12 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|