C18H19NO5 — CID 88896043
1,2,3-trimethoxy-5-[(Z)-2-(4-methoxy-3-nitrosophenyl)ethenyl]benzene (PubChem CID 88896043) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(Z)-2-(4-methoxy-3-nitrosophenyl)ethenyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(Z)-2-(4-methoxy-3-nitrosophenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 88896043 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(Z)-2-(4-methoxy-3-nitrosophenyl)ethenyl]benzene |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1N=O |
| InChI | InChI=1S/C18H19NO5/c1-21-15-8-7-12(9-14(15)19-20)5-6-13-10-16(22-2)18(24-4)17(11-13)23-3/h5-11H,1-4H3/b6-5- |
| InChIKey | WSWOTPALVQTLHT-WAYWQWQTSA-N |
| XLogP | 4.29 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|