C18H19N3O4 — CID 54425378
5-[2-(4-azido-3-methoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 54425378) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-[2-(4-azido-3-methoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[2-(4-azido-3-methoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 54425378 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-[2-(4-azido-3-methoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(C=Cc2cc(OC)c(OC)c(OC)c2)ccc1N=[N+]=[N-] |
| InChI | InChI=1S/C18H19N3O4/c1-22-15-9-12(7-8-14(15)20-21-19)5-6-13-10-16(23-2)18(25-4)17(11-13)24-3/h5-11H,1-4H3 |
| InChIKey | WDSBQVDSBBOEOV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|