C27H28N2O5 — CID 123766955
1-(4-aminophenyl)-3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one (PubChem CID 123766955) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one.
| Compound Name | 1-(4-aminophenyl)-3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one |
|---|---|
| PubChem CID | 123766955 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-(4-aminophenyl)-3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1/N=C/CC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C27H28N2O5/c1-31-24-12-7-18(5-6-19-16-25(32-2)27(34-4)26(17-19)33-3)15-22(24)29-14-13-23(30)20-8-10-21(28)11-9-20/h5-12,14-17H,13,28H2,1-4H3/b6-5-,29-14+ |
| InChIKey | RETUFAWMELNWKM-AMLWTXOOSA-N |
| XLogP | 5.45 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|