C27H25Cl2NO5 — CID 123872736
3-[3-chloro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imino-1-(4-chlorophenyl)propan-1-one (PubChem CID 123872736) has the molecular formula C27H25Cl2NO5 and a molecular weight of 514.41 g/mol. Its IUPAC name is 3-[3-chloro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imino-1-(4-chlorophenyl)propan-1-one.
| Compound Name | 3-[3-chloro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imino-1-(4-chlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 123872736 |
| Molecular Formula | C27H25Cl2NO5 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 3-[3-chloro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imino-1-(4-chlorophenyl)propan-1-one |
| SMILES | COc1cc(/C=C\c2cc(Cl)c(OC)c(/N=C/CC(=O)c3ccc(Cl)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H25Cl2NO5/c1-32-24-15-18(16-25(33-2)27(24)35-4)6-5-17-13-21(29)26(34-3)22(14-17)30-12-11-23(31)19-7-9-20(28)10-8-19/h5-10,12-16H,11H2,1-4H3/b6-5-,30-12+ |
| InChIKey | AREXPBREXRGPDT-AODDTJMASA-N |
| XLogP | 7.17 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|