C28H29NO6 — CID 123737865
3-[2,3-dimethoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imino-1-phenylpropan-1-one (PubChem CID 123737865) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is 3-[2,3-dimethoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imino-1-phenylpropan-1-one.
| Compound Name | 3-[2,3-dimethoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imino-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 123737865 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-[2,3-dimethoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imino-1-phenylpropan-1-one |
| SMILES | COc1cc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc(/N=C/CC(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C28H29NO6/c1-31-24-16-19(11-12-20-17-25(32-2)28(35-5)26(18-20)33-3)15-22(27(24)34-4)29-14-13-23(30)21-9-7-6-8-10-21/h6-12,14-18H,13H2,1-5H3/b12-11-,29-14+ |
| InChIKey | RHESBEZXNPMWTO-VFMXJPGGSA-N |
| XLogP | 5.88 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|