C26H26N2O4 — CID 123756886
1-(2-aminophenyl)-3-[3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one (PubChem CID 123756886) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 1-(2-aminophenyl)-3-[3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one.
| Compound Name | 1-(2-aminophenyl)-3-[3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one |
|---|---|
| PubChem CID | 123756886 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-(2-aminophenyl)-3-[3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one |
| SMILES | COc1cc(/C=C\c2cccc(/N=C/CC(=O)c3ccccc3N)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H26N2O4/c1-30-24-16-19(17-25(31-2)26(24)32-3)12-11-18-7-6-8-20(15-18)28-14-13-23(29)21-9-4-5-10-22(21)27/h4-12,14-17H,13,27H2,1-3H3/b12-11-,28-14+ |
| InChIKey | AXVAHPMQFSDGTF-LBGJVYMRSA-N |
| XLogP | 5.44 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|