C28H27ClFNO6 — CID 123368502
1-(3-chloro-4-methoxyphenyl)-3-[3-fluoro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one (PubChem CID 123368502) has the molecular formula C28H27ClFNO6 and a molecular weight of 527.98 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[3-fluoro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[3-fluoro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one |
|---|---|
| PubChem CID | 123368502 |
| Molecular Formula | C28H27ClFNO6 |
| Molecular Weight | 527.98 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[3-fluoro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]iminopropan-1-one |
| SMILES | COc1ccc(C(=O)C/C=N/c2cc(/C=C\c3cc(OC)c(OC)c(OC)c3)cc(F)c2OC)cc1Cl |
| InChI | InChI=1S/C28H27ClFNO6/c1-33-24-9-8-19(16-20(24)29)23(32)10-11-31-22-13-17(12-21(30)27(22)36-4)6-7-18-14-25(34-2)28(37-5)26(15-18)35-3/h6-9,11-16H,10H2,1-5H3/b7-6-,31-11+ |
| InChIKey | LMNKZTVWBBVAMT-VKKWBCGJSA-N |
| XLogP | 6.67 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.98 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|