C18H20N2O4 — CID 155813789
(NZ)-N-[(E)-1-(4-aminophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enylidene]hydroxylamine (PubChem CID 155813789) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (NZ)-N-[(E)-1-(4-aminophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(E)-1-(4-aminophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 155813789 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (NZ)-N-[(E)-1-(4-aminophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enylidene]hydroxylamine |
| SMILES | COc1cc(/C=C/C(=N/O)c2ccc(N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H20N2O4/c1-22-16-10-12(11-17(23-2)18(16)24-3)4-9-15(20-21)13-5-7-14(19)8-6-13/h4-11,21H,19H2,1-3H3/b9-4+,20-15- |
| InChIKey | NWWGGYVQKUAQQW-DGINWBCJSA-N |
| XLogP | 3.19 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|