C26H28O5 — CID 166666310
5-[(E)-2-(4-ethoxy-3-phenylmethoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 166666310) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 5-[(E)-2-(4-ethoxy-3-phenylmethoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(E)-2-(4-ethoxy-3-phenylmethoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 166666310 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 5-[(E)-2-(4-ethoxy-3-phenylmethoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | CCOc1ccc(/C=C/c2cc(OC)c(OC)c(OC)c2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H28O5/c1-5-30-22-14-13-19(15-23(22)31-18-20-9-7-6-8-10-20)11-12-21-16-24(27-2)26(29-4)25(17-21)28-3/h6-17H,5,18H2,1-4H3/b12-11+ |
| InChIKey | IWSULNJTBBFLKX-VAWYXSNFSA-N |
| XLogP | 5.86 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|