C30H28O4 — CID 101267905
1-[(E)-2-[3,4-bis(phenylmethoxy)phenyl]ethenyl]-3,5-dimethoxybenzene (PubChem CID 101267905) has the molecular formula C30H28O4 and a molecular weight of 452.55 g/mol. Its IUPAC name is 1-[(E)-2-[3,4-bis(phenylmethoxy)phenyl]ethenyl]-3,5-dimethoxybenzene.
| Compound Name | 1-[(E)-2-[3,4-bis(phenylmethoxy)phenyl]ethenyl]-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 101267905 |
| Molecular Formula | C30H28O4 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-[(E)-2-[3,4-bis(phenylmethoxy)phenyl]ethenyl]-3,5-dimethoxybenzene |
| SMILES | COc1cc(/C=C/c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)cc(OC)c1 |
| InChI | InChI=1S/C30H28O4/c1-31-27-17-26(18-28(20-27)32-2)14-13-23-15-16-29(33-21-24-9-5-3-6-10-24)30(19-23)34-22-25-11-7-4-8-12-25/h3-20H,21-22H2,1-2H3/b14-13+ |
| InChIKey | QUECROTXSAEPGR-BUHFOSPRSA-N |
| XLogP | 7.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|