C46H46N2O4S2+2 — CID 89191654
4-[(E)-2-(3-methoxy-4-phenylmethoxyphenyl)ethenyl]-1-[2-[2-[4-[(E)-2-(3-methoxy-4-phenylmethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium (PubChem CID 89191654) has the molecular formula C46H46N2O4S2+2 and a molecular weight of 755.02 g/mol. Its IUPAC name is 4-[(E)-2-(3-methoxy-4-phenylmethoxyphenyl)ethenyl]-1-[2-[2-[4-[(E)-2-(3-methoxy-4-phenylmethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium.
| Compound Name | 4-[(E)-2-(3-methoxy-4-phenylmethoxyphenyl)ethenyl]-1-[2-[2-[4-[(E)-2-(3-methoxy-4-phenylmethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 89191654 |
| Molecular Formula | C46H46N2O4S2+2 |
| Molecular Weight | 755.02 g/mol |
| Exact Mass | 754.29 |
| IUPAC Name | 4-[(E)-2-(3-methoxy-4-phenylmethoxyphenyl)ethenyl]-1-[2-[2-[4-[(E)-2-(3-methoxy-4-phenylmethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium |
| SMILES | COc1cc(/C=C/c2cc[n+](CCSSCC[n+]3ccc(/C=C/c4ccc(OCc5ccccc5)c(OC)c4)cc3)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C46H46N2O4S2/c1-49-45-33-39(17-19-43(45)51-35-41-9-5-3-6-10-41)15-13-37-21-25-47(26-22-37)29-31-53-54-32-30-48-27-23-38(24-28-48)14-16-40-18-20-44(46(34-40)50-2)52-36-42-11-7-4-8-12-42/h3-28,33-34H,29-32,35-36H2,1-2H3/q+2/b15-13+,16-14+ |
| InChIKey | FDBWAKRKBRHMQH-WXUKJITCSA-N |
| XLogP | 9.86 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.02 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|