C22H30NO7P — CID 85046153
N-diethoxyphosphoryl-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 85046153) has the molecular formula C22H30NO7P and a molecular weight of 451.46 g/mol. Its IUPAC name is N-diethoxyphosphoryl-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
| Compound Name | N-diethoxyphosphoryl-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 85046153 |
| Molecular Formula | C22H30NO7P |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-diethoxyphosphoryl-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | CCOP(=O)(Nc1cc(C=Cc2cc(OC)c(OC)c(OC)c2)ccc1OC)OCC |
| InChI | InChI=1S/C22H30NO7P/c1-7-29-31(24,30-8-2)23-18-13-16(11-12-19(18)25-3)9-10-17-14-20(26-4)22(28-6)21(15-17)27-5/h9-15H,7-8H2,1-6H3,(H,23,24) |
| InChIKey | JVADXWAQCLSYMC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|