C15H23O6P — CID 101023826
5-[(E)-2-diethoxyphosphorylethenyl]-1,2,3-trimethoxybenzene (PubChem CID 101023826) has the molecular formula C15H23O6P and a molecular weight of 330.32 g/mol. Its IUPAC name is 5-[(E)-2-diethoxyphosphorylethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(E)-2-diethoxyphosphorylethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 101023826 |
| Molecular Formula | C15H23O6P |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5-[(E)-2-diethoxyphosphorylethenyl]-1,2,3-trimethoxybenzene |
| SMILES | CCOP(=O)(/C=C/c1cc(OC)c(OC)c(OC)c1)OCC |
| InChI | InChI=1S/C15H23O6P/c1-6-20-22(16,21-7-2)9-8-12-10-13(17-3)15(19-5)14(11-12)18-4/h8-11H,6-7H2,1-5H3/b9-8+ |
| InChIKey | GZNPAGQCKGLYKP-CMDGGOBGSA-N |
| XLogP | 3.95 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|