C29H31N4O7P — CID 135939745
4-[(E)-2-diethoxyphosphorylethenyl]-2-[2-hydroxy-3-methoxy-5-[(E)-(phthalazin-1-ylhydrazinylidene)methyl]phenyl]-6-methoxyphenol (PubChem CID 135939745) has the molecular formula C29H31N4O7P and a molecular weight of 578.56 g/mol. Its IUPAC name is 4-[(E)-2-diethoxyphosphorylethenyl]-2-[2-hydroxy-3-methoxy-5-[(E)-(phthalazin-1-ylhydrazinylidene)methyl]phenyl]-6-methoxyphenol.
| Compound Name | 4-[(E)-2-diethoxyphosphorylethenyl]-2-[2-hydroxy-3-methoxy-5-[(E)-(phthalazin-1-ylhydrazinylidene)methyl]phenyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135939745 |
| Molecular Formula | C29H31N4O7P |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | 4-[(E)-2-diethoxyphosphorylethenyl]-2-[2-hydroxy-3-methoxy-5-[(E)-(phthalazin-1-ylhydrazinylidene)methyl]phenyl]-6-methoxyphenol |
| SMILES | CCOP(=O)(/C=C/c1cc(OC)c(O)c(-c2cc(/C=N/Nc3nncc4ccccc34)cc(OC)c2O)c1)OCC |
| InChI | InChI=1S/C29H31N4O7P/c1-5-39-41(36,40-6-2)12-11-19-13-23(27(34)25(15-19)37-3)24-14-20(16-26(38-4)28(24)35)17-30-32-29-22-10-8-7-9-21(22)18-31-33-29/h7-18,34-35H,5-6H2,1-4H3,(H,32,33)/b12-11+,30-17+ |
| InChIKey | LCBPKCRASMWMMS-JCZFOHFMSA-N |
| XLogP | 6.41 |
| TPSA | 144.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|