C18H16N4O4 — CID 6412287
2,3-dimethoxy-6-[(Z)-(phthalazin-1-ylhydrazinylidene)methyl]benzoic acid (PubChem CID 6412287) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-(phthalazin-1-ylhydrazinylidene)methyl]benzoic acid.
| Compound Name | 2,3-dimethoxy-6-[(Z)-(phthalazin-1-ylhydrazinylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 6412287 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-(phthalazin-1-ylhydrazinylidene)methyl]benzoic acid |
| SMILES | COc1ccc(/C=N\Nc2nncc3ccccc23)c(C(=O)O)c1OC |
| InChI | InChI=1S/C18H16N4O4/c1-25-14-8-7-12(15(18(23)24)16(14)26-2)10-20-22-17-13-6-4-3-5-11(13)9-19-21-17/h3-10H,1-2H3,(H,21,22)(H,23,24)/b20-10- |
| InChIKey | GJMQTRVQCPXRAW-JMIUGGIZSA-N |
| XLogP | 2.79 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|